C12H13N5 — CID 150029396
4-(4-amino-4-azidocyclohexa-1,5-dien-1-yl)aniline (PubChem CID 150029396) has the molecular formula C12H13N5 and a molecular weight of 227.27 g/mol. Its IUPAC name is 4-(4-amino-4-azidocyclohexa-1,5-dien-1-yl)aniline.
| Compound Name | 4-(4-amino-4-azidocyclohexa-1,5-dien-1-yl)aniline |
|---|---|
| PubChem CID | 150029396 |
| Molecular Formula | C12H13N5 |
| Molecular Weight | 227.27 g/mol |
| Exact Mass | 227.12 |
| IUPAC Name | 4-(4-amino-4-azidocyclohexa-1,5-dien-1-yl)aniline |
| SMILES | [N-]=[N+]=NC1(N)C=CC(c2ccc(N)cc2)=CC1 |
| InChI | InChI=1S/C12H13N5/c13-11-3-1-9(2-4-11)10-5-7-12(14,8-6-10)16-17-15/h1-7H,8,13-14H2 |
| InChIKey | DGXYACFICJBVOF-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 100.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.27 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|