About 4-[1-(4-aminophenoxy)-4-phenylcyclohexa-2,4-dien-1-yl]oxyaniline
4-[1-(4-aminophenoxy)-4-phenylcyclohexa-2,4-dien-1-yl]oxyaniline (PubChem CID 66911320) has the molecular formula C24H22N2O2
and a molecular weight of 370.45 g/mol. Its IUPAC name is 4-[1-(4-aminophenoxy)-4-phenylcyclohexa-2,4-dien-1-yl]oxyaniline.
Molecular Properties
| Compound Name | 4-[1-(4-aminophenoxy)-4-phenylcyclohexa-2,4-dien-1-yl]oxyaniline |
| PubChem CID | 66911320 |
| Molecular Formula | C24H22N2O2 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.17 |
| IUPAC Name | 4-[1-(4-aminophenoxy)-4-phenylcyclohexa-2,4-dien-1-yl]oxyaniline |
| SMILES | Nc1ccc(OC2(Oc3ccc(N)cc3)C=CC(c3ccccc3)=CC2)cc1 |
| InChI | InChI=1S/C24H22N2O2/c25-20-6-10-22(11-7-20)27-24(28-23-12-8-21(26)9-13-23)16-14-19(15-17-24)18-4-2-1-3-5-18/h1-16H,17,25-26H2 |
| InChIKey | HHPGHFMVYWBJQW-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 4-[1-(4-aminophenoxy)-4-phenylcyclohexa-2,4-dien-1-yl]oxyaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[1-(4-aminophenoxy)-4-phenylcyclohexa-2,4-dien-1-yl]oxyaniline?
The IUPAC name of 4-[1-(4-aminophenoxy)-4-phenylcyclohexa-2,4-dien-1-yl]oxyaniline (CID 66911320) is 4-[1-(4-aminophenoxy)-4-phenylcyclohexa-2,4-dien-1-yl]oxyaniline.
What is the SMILES notation for 4-[1-(4-aminophenoxy)-4-phenylcyclohexa-2,4-dien-1-yl]oxyaniline?
The canonical SMILES for 4-[1-(4-aminophenoxy)-4-phenylcyclohexa-2,4-dien-1-yl]oxyaniline is Nc1ccc(OC2(Oc3ccc(N)cc3)C=CC(c3ccccc3)=CC2)cc1.
What is the InChIKey of 4-[1-(4-aminophenoxy)-4-phenylcyclohexa-2,4-dien-1-yl]oxyaniline?
The InChIKey is HHPGHFMVYWBJQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H22N2O2/c25-20-6-10-22(11-7-20)27-24(28-23-12-8-21(26)9-13-23)16-14-19(15-17-24)18-4-2-1-3-5-18/h1-16H,17,25-26H2.
What are the key properties of 4-[1-(4-aminophenoxy)-4-phenylcyclohexa-2,4-dien-1-yl]oxyaniline?
4-[1-(4-aminophenoxy)-4-phenylcyclohexa-2,4-dien-1-yl]oxyaniline has a molecular weight of 370.45 g/mol, XLogP of 5.05, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[1-(4-aminophenoxy)-4-phenylcyclohexa-2,4-dien-1-yl]oxyaniline is sourced from PubChem (CID 66911320), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).