C12H13FN2 — CID 152526557
4-(4-amino-4-fluorocyclohexa-1,5-dien-1-yl)aniline (PubChem CID 152526557) has the molecular formula C12H13FN2 and a molecular weight of 204.25 g/mol. Its IUPAC name is 4-(4-amino-4-fluorocyclohexa-1,5-dien-1-yl)aniline.
| Compound Name | 4-(4-amino-4-fluorocyclohexa-1,5-dien-1-yl)aniline |
|---|---|
| PubChem CID | 152526557 |
| Molecular Formula | C12H13FN2 |
| Molecular Weight | 204.25 g/mol |
| Exact Mass | 204.11 |
| IUPAC Name | 4-(4-amino-4-fluorocyclohexa-1,5-dien-1-yl)aniline |
| SMILES | Nc1ccc(C2=CCC(N)(F)C=C2)cc1 |
| InChI | InChI=1S/C12H13FN2/c13-12(15)7-5-10(6-8-12)9-1-3-11(14)4-2-9/h1-7H,8,14-15H2 |
| InChIKey | YIQHMCDCXKCUIM-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.25 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|