C26H26N2O — CID 139831884
2-[2-[4-[1-amino-4-(4-aminophenyl)cyclohexa-2,4-dien-1-yl]phenyl]phenyl]ethanol (PubChem CID 139831884) has the molecular formula C26H26N2O and a molecular weight of 382.51 g/mol. Its IUPAC name is 2-[2-[4-[1-amino-4-(4-aminophenyl)cyclohexa-2,4-dien-1-yl]phenyl]phenyl]ethanol.
| Compound Name | 2-[2-[4-[1-amino-4-(4-aminophenyl)cyclohexa-2,4-dien-1-yl]phenyl]phenyl]ethanol |
|---|---|
| PubChem CID | 139831884 |
| Molecular Formula | C26H26N2O |
| Molecular Weight | 382.51 g/mol |
| Exact Mass | 382.20 |
| IUPAC Name | 2-[2-[4-[1-amino-4-(4-aminophenyl)cyclohexa-2,4-dien-1-yl]phenyl]phenyl]ethanol |
| SMILES | Nc1ccc(C2=CCC(N)(c3ccc(-c4ccccc4CCO)cc3)C=C2)cc1 |
| InChI | InChI=1S/C26H26N2O/c27-24-11-7-19(8-12-24)20-13-16-26(28,17-14-20)23-9-5-22(6-10-23)25-4-2-1-3-21(25)15-18-29/h1-14,16,29H,15,17-18,27-28H2 |
| InChIKey | QDMMYVHKCLNFPU-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.51 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|