C15H18N2 — CID 174870617
4-(2-prop-2-enylphenyl)cyclohexa-2,4-diene-1,1-diamine (PubChem CID 174870617) has the molecular formula C15H18N2 and a molecular weight of 226.32 g/mol. Its IUPAC name is 4-(2-prop-2-enylphenyl)cyclohexa-2,4-diene-1,1-diamine.
| Compound Name | 4-(2-prop-2-enylphenyl)cyclohexa-2,4-diene-1,1-diamine |
|---|---|
| PubChem CID | 174870617 |
| Molecular Formula | C15H18N2 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.15 |
| IUPAC Name | 4-(2-prop-2-enylphenyl)cyclohexa-2,4-diene-1,1-diamine |
| SMILES | C=CCc1ccccc1C1=CCC(N)(N)C=C1 |
| InChI | InChI=1S/C15H18N2/c1-2-5-12-6-3-4-7-14(12)13-8-10-15(16,17)11-9-13/h2-4,6-10H,1,5,11,16-17H2 |
| InChIKey | QUQUENMYJSCNIE-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|