About 4-(4-phenylphenyl)-1-prop-2-enylcyclohexa-2,4-diene-1-carbonitrile
4-(4-phenylphenyl)-1-prop-2-enylcyclohexa-2,4-diene-1-carbonitrile (PubChem CID 67941375) has the molecular formula C22H19N
and a molecular weight of 297.40 g/mol. Its IUPAC name is 4-(4-phenylphenyl)-1-prop-2-enylcyclohexa-2,4-diene-1-carbonitrile.
Molecular Properties
| Compound Name | 4-(4-phenylphenyl)-1-prop-2-enylcyclohexa-2,4-diene-1-carbonitrile |
| PubChem CID | 67941375 |
| Molecular Formula | C22H19N |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | 4-(4-phenylphenyl)-1-prop-2-enylcyclohexa-2,4-diene-1-carbonitrile |
| SMILES | C=CCC1(C#N)C=CC(c2ccc(-c3ccccc3)cc2)=CC1 |
| InChI | InChI=1S/C22H19N/c1-2-14-22(17-23)15-12-21(13-16-22)20-10-8-19(9-11-20)18-6-4-3-5-7-18/h2-13,15H,1,14,16H2 |
| InChIKey | FAXQMMFWZJEESO-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-(4-phenylphenyl)-1-prop-2-enylcyclohexa-2,4-diene-1-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-phenylphenyl)-1-prop-2-enylcyclohexa-2,4-diene-1-carbonitrile?
The IUPAC name of 4-(4-phenylphenyl)-1-prop-2-enylcyclohexa-2,4-diene-1-carbonitrile (CID 67941375) is 4-(4-phenylphenyl)-1-prop-2-enylcyclohexa-2,4-diene-1-carbonitrile.
What is the SMILES notation for 4-(4-phenylphenyl)-1-prop-2-enylcyclohexa-2,4-diene-1-carbonitrile?
The canonical SMILES for 4-(4-phenylphenyl)-1-prop-2-enylcyclohexa-2,4-diene-1-carbonitrile is C=CCC1(C#N)C=CC(c2ccc(-c3ccccc3)cc2)=CC1.
What is the InChIKey of 4-(4-phenylphenyl)-1-prop-2-enylcyclohexa-2,4-diene-1-carbonitrile?
The InChIKey is FAXQMMFWZJEESO-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H19N/c1-2-14-22(17-23)15-12-21(13-16-22)20-10-8-19(9-11-20)18-6-4-3-5-7-18/h2-13,15H,1,14,16H2.
What are the key properties of 4-(4-phenylphenyl)-1-prop-2-enylcyclohexa-2,4-diene-1-carbonitrile?
4-(4-phenylphenyl)-1-prop-2-enylcyclohexa-2,4-diene-1-carbonitrile has a molecular weight of 297.40 g/mol, XLogP of 5.78, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-phenylphenyl)-1-prop-2-enylcyclohexa-2,4-diene-1-carbonitrile is sourced from PubChem (CID 67941375), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).