C44H45N — CID 69429761
4-(4-ethenylphenyl)-N,N-bis(4-phenyl-1-propan-2-ylcyclohexa-2,4-dien-1-yl)aniline (PubChem CID 69429761) has the molecular formula C44H45N and a molecular weight of 587.85 g/mol. Its IUPAC name is 4-(4-ethenylphenyl)-N,N-bis(4-phenyl-1-propan-2-ylcyclohexa-2,4-dien-1-yl)aniline.
| Compound Name | 4-(4-ethenylphenyl)-N,N-bis(4-phenyl-1-propan-2-ylcyclohexa-2,4-dien-1-yl)aniline |
|---|---|
| PubChem CID | 69429761 |
| Molecular Formula | C44H45N |
| Molecular Weight | 587.85 g/mol |
| Exact Mass | 587.36 |
| IUPAC Name | 4-(4-ethenylphenyl)-N,N-bis(4-phenyl-1-propan-2-ylcyclohexa-2,4-dien-1-yl)aniline |
| SMILES | C=Cc1ccc(-c2ccc(N(C3(C(C)C)C=CC(c4ccccc4)=CC3)C3(C(C)C)C=CC(c4ccccc4)=CC3)cc2)cc1 |
| InChI | InChI=1S/C44H45N/c1-6-35-17-19-38(20-18-35)39-21-23-42(24-22-39)45(43(33(2)3)29-25-40(26-30-43)36-13-9-7-10-14-36)44(34(4)5)31-27-41(28-32-44)37-15-11-8-12-16-37/h6-29,31,33-34H,1,30,32H2,2-5H3 |
| InChIKey | FWTDSUMMRVINSQ-UHFFFAOYSA-N |
| XLogP | 11.68 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.85 |
| LogP ≤ 5 | 11.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |