About 1-phenyl-2-prop-2-enylbenzene;stilbene
1-phenyl-2-prop-2-enylbenzene;stilbene (PubChem CID 173298564) has the molecular formula C29H26
and a molecular weight of 374.53 g/mol. Its IUPAC name is 1-phenyl-2-prop-2-enylbenzene;stilbene.
Molecular Properties
| Compound Name | 1-phenyl-2-prop-2-enylbenzene;stilbene |
| PubChem CID | 173298564 |
| Molecular Formula | C29H26 |
| Molecular Weight | 374.53 g/mol |
| Exact Mass | 374.20 |
| IUPAC Name | 1-phenyl-2-prop-2-enylbenzene;stilbene |
| SMILES | C(=Cc1ccccc1)c1ccccc1.C=CCc1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C15H14.C14H12/c1-2-8-13-11-6-7-12-15(13)14-9-4-3-5-10-14;1-3-7-13(8-4-1)11-12-14-9-5-2-6-10-14/h2-7,9-12H,1,8H2;1-12H |
| InChIKey | HMYKXGALZCJTBN-UHFFFAOYSA-N |
| XLogP | 7.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 374.53 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 1-phenyl-2-prop-2-enylbenzene;stilbene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenyl-2-prop-2-enylbenzene;stilbene?
The IUPAC name of 1-phenyl-2-prop-2-enylbenzene;stilbene (CID 173298564) is 1-phenyl-2-prop-2-enylbenzene;stilbene.
What is the SMILES notation for 1-phenyl-2-prop-2-enylbenzene;stilbene?
The canonical SMILES for 1-phenyl-2-prop-2-enylbenzene;stilbene is C(=Cc1ccccc1)c1ccccc1.C=CCc1ccccc1-c1ccccc1.
What is the InChIKey of 1-phenyl-2-prop-2-enylbenzene;stilbene?
The InChIKey is HMYKXGALZCJTBN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14.C14H12/c1-2-8-13-11-6-7-12-15(13)14-9-4-3-5-10-14;1-3-7-13(8-4-1)11-12-14-9-5-2-6-10-14/h2-7,9-12H,1,8H2;1-12H.
What are the key properties of 1-phenyl-2-prop-2-enylbenzene;stilbene?
1-phenyl-2-prop-2-enylbenzene;stilbene has a molecular weight of 374.53 g/mol, XLogP of 7.94, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenyl-2-prop-2-enylbenzene;stilbene is sourced from PubChem (CID 173298564), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).