About 2-prop-2-enylbenzoic acid
2-prop-2-enylbenzoic acid (PubChem CID 2752991) has the molecular formula C10H10O2
and a molecular weight of 162.19 g/mol. Its IUPAC name is 2-prop-2-enylbenzoic acid.
Molecular Properties
| Compound Name | 2-prop-2-enylbenzoic acid |
| PubChem CID | 2752991 |
| Molecular Formula | C10H10O2 |
| Molecular Weight | 162.19 g/mol |
| Exact Mass | 162.07 |
| IUPAC Name | 2-prop-2-enylbenzoic acid |
| SMILES | C=CCc1ccccc1C(=O)O |
| InChI | InChI=1S/C10H10O2/c1-2-5-8-6-3-4-7-9(8)10(11)12/h2-4,6-7H,1,5H2,(H,11,12) |
| InChIKey | PMXHYECRRNWMIM-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.19 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-prop-2-enylbenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-prop-2-enylbenzoic acid?
The IUPAC name of 2-prop-2-enylbenzoic acid (CID 2752991) is 2-prop-2-enylbenzoic acid.
What is the SMILES notation for 2-prop-2-enylbenzoic acid?
The canonical SMILES for 2-prop-2-enylbenzoic acid is C=CCc1ccccc1C(=O)O.
What is the InChIKey of 2-prop-2-enylbenzoic acid?
The InChIKey is PMXHYECRRNWMIM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10O2/c1-2-5-8-6-3-4-7-9(8)10(11)12/h2-4,6-7H,1,5H2,(H,11,12).
What are the key properties of 2-prop-2-enylbenzoic acid?
2-prop-2-enylbenzoic acid has a molecular weight of 162.19 g/mol, XLogP of 2.11, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-prop-2-enylbenzoic acid is sourced from PubChem (CID 2752991), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).