2-prop-2-enylbenzoic acid

C10H10O2 — CID 2752991

IUPAC2-prop-2-enylbenzoic acid
SMILESC=CCc1ccccc1C(=O)O
InChIInChI=1S/C10H10O2/c1-2-5-8-6-3-4-7-9(8)10(11)12/h2-4,6-7H,1,5H2,(H,11,12)
InChIKeyPMXHYECRRNWMIM-UHFFFAOYSA-N
MW162.19 g/mol
LogP2.11
Rot. Bonds3

About 2-prop-2-enylbenzoic acid

2-prop-2-enylbenzoic acid (PubChem CID 2752991) has the molecular formula C10H10O2 and a molecular weight of 162.19 g/mol. Its IUPAC name is 2-prop-2-enylbenzoic acid.

Molecular Properties

Compound Name2-prop-2-enylbenzoic acid
PubChem CID2752991
Molecular FormulaC10H10O2
Molecular Weight162.19 g/mol
Exact Mass162.07
IUPAC Name2-prop-2-enylbenzoic acid
SMILESC=CCc1ccccc1C(=O)O
InChIInChI=1S/C10H10O2/c1-2-5-8-6-3-4-7-9(8)10(11)12/h2-4,6-7H,1,5H2,(H,11,12)
InChIKeyPMXHYECRRNWMIM-UHFFFAOYSA-N
XLogP2.11
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds3
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500162.19
LogP ≤ 52.11
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze 2-prop-2-enylbenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-prop-2-enylbenzoic acid?
The IUPAC name of 2-prop-2-enylbenzoic acid (CID 2752991) is 2-prop-2-enylbenzoic acid.
What is the SMILES notation for 2-prop-2-enylbenzoic acid?
The canonical SMILES for 2-prop-2-enylbenzoic acid is C=CCc1ccccc1C(=O)O.
What is the InChIKey of 2-prop-2-enylbenzoic acid?
The InChIKey is PMXHYECRRNWMIM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10O2/c1-2-5-8-6-3-4-7-9(8)10(11)12/h2-4,6-7H,1,5H2,(H,11,12).
What are the key properties of 2-prop-2-enylbenzoic acid?
2-prop-2-enylbenzoic acid has a molecular weight of 162.19 g/mol, XLogP of 2.11, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-prop-2-enylbenzoic acid is sourced from PubChem (CID 2752991), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).