About 2-(2-Butenyl)benzoic acid
2-(2-Butenyl)benzoic acid (PubChem CID 11217549) has the molecular formula C11H12O2
and a molecular weight of 176.21 g/mol. Its IUPAC name is 2-[(E)-but-2-enyl]benzoic acid.
Molecular Properties
| Compound Name | 2-(2-Butenyl)benzoic acid |
| PubChem CID | 11217549 |
| Molecular Formula | C11H12O2 |
| Molecular Weight | 176.21 g/mol |
| Exact Mass | 176.08 |
| IUPAC Name | 2-[(E)-but-2-enyl]benzoic acid |
| SMILES | C/C=C/CC1=CC=CC=C1C(=O)O |
| InChI | InChI=1S/C11H12O2/c1-2-3-6-9-7-4-5-8-10(9)11(12)13/h2-5,7-8H,6H2,1H3,(H,12,13)/b3-2+ |
| InChIKey | ATHHTSBRUXTTGZ-NSCUHMNNSA-N |
| XLogP | 3.40 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | 196 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.21 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-Butenyl)benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-Butenyl)benzoic acid?
The IUPAC name of 2-(2-Butenyl)benzoic acid (CID 11217549) is 2-[(E)-but-2-enyl]benzoic acid.
What is the SMILES notation for 2-(2-Butenyl)benzoic acid?
The canonical SMILES for 2-(2-Butenyl)benzoic acid is C/C=C/CC1=CC=CC=C1C(=O)O.
What is the InChIKey of 2-(2-Butenyl)benzoic acid?
The InChIKey is ATHHTSBRUXTTGZ-NSCUHMNNSA-N. The full InChI is InChI=1S/C11H12O2/c1-2-3-6-9-7-4-5-8-10(9)11(12)13/h2-5,7-8H,6H2,1H3,(H,12,13)/b3-2+.
What are the key properties of 2-(2-Butenyl)benzoic acid?
2-(2-Butenyl)benzoic acid has a molecular weight of 176.21 g/mol, XLogP of 3.40, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-Butenyl)benzoic acid is sourced from PubChem (CID 11217549), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).