4,5-bis(prop-2-enyl)naphthalene-1-carboxylic acid

C17H16O2 — CID 139984847

IUPAC4,5-bis(prop-2-enyl)naphthalene-1-carboxylic acid
SMILESC=CCc1cccc2c(C(=O)O)ccc(CC=C)c12
InChIInChI=1S/C17H16O2/c1-3-6-12-8-5-9-14-15(17(18)19)11-10-13(7-4-2)16(12)14/h3-5,8-11H,1-2,6-7H2,(H,18,19)
InChIKeySHWFIVVIQFEABX-UHFFFAOYSA-N
MW252.31 g/mol
LogP3.99
Rot. Bonds5

About 4,5-bis(prop-2-enyl)naphthalene-1-carboxylic acid

4,5-bis(prop-2-enyl)naphthalene-1-carboxylic acid (PubChem CID 139984847) has the molecular formula C17H16O2 and a molecular weight of 252.31 g/mol. Its IUPAC name is 4,5-bis(prop-2-enyl)naphthalene-1-carboxylic acid.

Molecular Properties

Compound Name4,5-bis(prop-2-enyl)naphthalene-1-carboxylic acid
PubChem CID139984847
Molecular FormulaC17H16O2
Molecular Weight252.31 g/mol
Exact Mass252.12
IUPAC Name4,5-bis(prop-2-enyl)naphthalene-1-carboxylic acid
SMILESC=CCc1cccc2c(C(=O)O)ccc(CC=C)c12
InChIInChI=1S/C17H16O2/c1-3-6-12-8-5-9-14-15(17(18)19)11-10-13(7-4-2)16(12)14/h3-5,8-11H,1-2,6-7H2,(H,18,19)
InChIKeySHWFIVVIQFEABX-UHFFFAOYSA-N
XLogP3.99
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds5
Heavy Atoms19
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500252.31
LogP ≤ 53.99
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze 4,5-bis(prop-2-enyl)naphthalene-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4,5-bis(prop-2-enyl)naphthalene-1-carboxylic acid?
The IUPAC name of 4,5-bis(prop-2-enyl)naphthalene-1-carboxylic acid (CID 139984847) is 4,5-bis(prop-2-enyl)naphthalene-1-carboxylic acid.
What is the SMILES notation for 4,5-bis(prop-2-enyl)naphthalene-1-carboxylic acid?
The canonical SMILES for 4,5-bis(prop-2-enyl)naphthalene-1-carboxylic acid is C=CCc1cccc2c(C(=O)O)ccc(CC=C)c12.
What is the InChIKey of 4,5-bis(prop-2-enyl)naphthalene-1-carboxylic acid?
The InChIKey is SHWFIVVIQFEABX-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16O2/c1-3-6-12-8-5-9-14-15(17(18)19)11-10-13(7-4-2)16(12)14/h3-5,8-11H,1-2,6-7H2,(H,18,19).
What are the key properties of 4,5-bis(prop-2-enyl)naphthalene-1-carboxylic acid?
4,5-bis(prop-2-enyl)naphthalene-1-carboxylic acid has a molecular weight of 252.31 g/mol, XLogP of 3.99, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-bis(prop-2-enyl)naphthalene-1-carboxylic acid is sourced from PubChem (CID 139984847), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).