C17H16O2 — CID 139984848
3,5-bis(prop-2-enyl)naphthalene-2-carboxylic acid (PubChem CID 139984848) has the molecular formula C17H16O2 and a molecular weight of 252.31 g/mol. Its IUPAC name is 3,5-bis(prop-2-enyl)naphthalene-2-carboxylic acid.
| Compound Name | 3,5-bis(prop-2-enyl)naphthalene-2-carboxylic acid |
|---|---|
| PubChem CID | 139984848 |
| Molecular Formula | C17H16O2 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.12 |
| IUPAC Name | 3,5-bis(prop-2-enyl)naphthalene-2-carboxylic acid |
| SMILES | C=CCc1cc2c(CC=C)cccc2cc1C(=O)O |
| InChI | InChI=1S/C17H16O2/c1-3-6-12-8-5-9-14-11-16(17(18)19)13(7-4-2)10-15(12)14/h3-5,8-11H,1-2,6-7H2,(H,18,19) |
| InChIKey | NQPVGDGYABRXMK-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|