About sodium;naphthalene-1-sulfonate;1-phenyl-2-prop-2-enylbenzene
sodium;naphthalene-1-sulfonate;1-phenyl-2-prop-2-enylbenzene (PubChem CID 174496781) has the molecular formula C25H21NaO3S
and a molecular weight of 424.50 g/mol. Its IUPAC name is sodium;naphthalene-1-sulfonate;1-phenyl-2-prop-2-enylbenzene.
Molecular Properties
| Compound Name | sodium;naphthalene-1-sulfonate;1-phenyl-2-prop-2-enylbenzene |
| PubChem CID | 174496781 |
| Molecular Formula | C25H21NaO3S |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.11 |
| IUPAC Name | sodium;naphthalene-1-sulfonate;1-phenyl-2-prop-2-enylbenzene |
| SMILES | C=CCc1ccccc1-c1ccccc1.O=S(=O)([O-])c1cccc2ccccc12.[Na+] |
| InChI | InChI=1S/C15H14.C10H8O3S.Na/c1-2-8-13-11-6-7-12-15(13)14-9-4-3-5-10-14;11-14(12,13)10-7-3-5-8-4-1-2-6-9(8)10;/h2-7,9-12H,1,8H2;1-7H,(H,11,12,13);/q;;+1/p-1 |
| InChIKey | JMMMOQABZTVEIO-UHFFFAOYSA-M |
| XLogP | 2.83 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze sodium;naphthalene-1-sulfonate;1-phenyl-2-prop-2-enylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;naphthalene-1-sulfonate;1-phenyl-2-prop-2-enylbenzene?
The IUPAC name of sodium;naphthalene-1-sulfonate;1-phenyl-2-prop-2-enylbenzene (CID 174496781) is sodium;naphthalene-1-sulfonate;1-phenyl-2-prop-2-enylbenzene.
What is the SMILES notation for sodium;naphthalene-1-sulfonate;1-phenyl-2-prop-2-enylbenzene?
The canonical SMILES for sodium;naphthalene-1-sulfonate;1-phenyl-2-prop-2-enylbenzene is C=CCc1ccccc1-c1ccccc1.O=S(=O)([O-])c1cccc2ccccc12.[Na+].
What is the InChIKey of sodium;naphthalene-1-sulfonate;1-phenyl-2-prop-2-enylbenzene?
The InChIKey is JMMMOQABZTVEIO-UHFFFAOYSA-M. The full InChI is InChI=1S/C15H14.C10H8O3S.Na/c1-2-8-13-11-6-7-12-15(13)14-9-4-3-5-10-14;11-14(12,13)10-7-3-5-8-4-1-2-6-9(8)10;/h2-7,9-12H,1,8H2;1-7H,(H,11,12,13);/q;;+1/p-1.
What are the key properties of sodium;naphthalene-1-sulfonate;1-phenyl-2-prop-2-enylbenzene?
sodium;naphthalene-1-sulfonate;1-phenyl-2-prop-2-enylbenzene has a molecular weight of 424.50 g/mol, XLogP of 2.83, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;naphthalene-1-sulfonate;1-phenyl-2-prop-2-enylbenzene is sourced from PubChem (CID 174496781), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).