C25H21NaO3S — CID 174496781
sodium;naphthalene-1-sulfonate;1-phenyl-2-prop-2-enylbenzene (PubChem CID 174496781) has the molecular formula C25H21NaO3S and a molecular weight of 424.50 g/mol. Its IUPAC name is sodium;naphthalene-1-sulfonate;1-phenyl-2-prop-2-enylbenzene.
| Compound Name | sodium;naphthalene-1-sulfonate;1-phenyl-2-prop-2-enylbenzene |
|---|---|
| PubChem CID | 174496781 |
| Molecular Formula | C25H21NaO3S |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.11 |
| IUPAC Name | sodium;naphthalene-1-sulfonate;1-phenyl-2-prop-2-enylbenzene |
| SMILES | C=CCc1ccccc1-c1ccccc1.O=S(=O)([O-])c1cccc2ccccc12.[Na+] |
| InChI | InChI=1S/C15H14.C10H8O3S.Na/c1-2-8-13-11-6-7-12-15(13)14-9-4-3-5-10-14;11-14(12,13)10-7-3-5-8-4-1-2-6-9(8)10;/h2-7,9-12H,1,8H2;1-7H,(H,11,12,13);/q;;+1/p-1 |
| InChIKey | JMMMOQABZTVEIO-UHFFFAOYSA-M |
| XLogP | 2.83 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|