About sodium;benzenesulfonate;2-prop-2-enylphenol
sodium;benzenesulfonate;2-prop-2-enylphenol (PubChem CID 174320644) has the molecular formula C15H15NaO4S
and a molecular weight of 314.34 g/mol. Its IUPAC name is sodium;benzenesulfonate;2-prop-2-enylphenol.
Molecular Properties
| Compound Name | sodium;benzenesulfonate;2-prop-2-enylphenol |
| PubChem CID | 174320644 |
| Molecular Formula | C15H15NaO4S |
| Molecular Weight | 314.34 g/mol |
| Exact Mass | 314.06 |
| IUPAC Name | sodium;benzenesulfonate;2-prop-2-enylphenol |
| SMILES | C=CCc1ccccc1O.O=S(=O)([O-])c1ccccc1.[Na+] |
| InChI | InChI=1S/C9H10O.C6H6O3S.Na/c1-2-5-8-6-3-4-7-9(8)10;7-10(8,9)6-4-2-1-3-5-6;/h2-4,6-7,10H,1,5H2;1-5H,(H,7,8,9);/q;;+1/p-1 |
| InChIKey | ZCTVPMGOXBWYGI-UHFFFAOYSA-M |
| XLogP | -0.28 |
| TPSA | 77.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.34 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze sodium;benzenesulfonate;2-prop-2-enylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;benzenesulfonate;2-prop-2-enylphenol?
The IUPAC name of sodium;benzenesulfonate;2-prop-2-enylphenol (CID 174320644) is sodium;benzenesulfonate;2-prop-2-enylphenol.
What is the SMILES notation for sodium;benzenesulfonate;2-prop-2-enylphenol?
The canonical SMILES for sodium;benzenesulfonate;2-prop-2-enylphenol is C=CCc1ccccc1O.O=S(=O)([O-])c1ccccc1.[Na+].
What is the InChIKey of sodium;benzenesulfonate;2-prop-2-enylphenol?
The InChIKey is ZCTVPMGOXBWYGI-UHFFFAOYSA-M. The full InChI is InChI=1S/C9H10O.C6H6O3S.Na/c1-2-5-8-6-3-4-7-9(8)10;7-10(8,9)6-4-2-1-3-5-6;/h2-4,6-7,10H,1,5H2;1-5H,(H,7,8,9);/q;;+1/p-1.
What are the key properties of sodium;benzenesulfonate;2-prop-2-enylphenol?
sodium;benzenesulfonate;2-prop-2-enylphenol has a molecular weight of 314.34 g/mol, XLogP of -0.28, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;benzenesulfonate;2-prop-2-enylphenol is sourced from PubChem (CID 174320644), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).