About sodium;benzenesulfonate;fluoroethene
sodium;benzenesulfonate;fluoroethene (PubChem CID 159746801) has the molecular formula C8H8FNaO3S
and a molecular weight of 226.20 g/mol. Its IUPAC name is sodium;benzenesulfonate;fluoroethene.
Molecular Properties
| Compound Name | sodium;benzenesulfonate;fluoroethene |
| PubChem CID | 159746801 |
| Molecular Formula | C8H8FNaO3S |
| Molecular Weight | 226.20 g/mol |
| Exact Mass | 226.01 |
| IUPAC Name | sodium;benzenesulfonate;fluoroethene |
| SMILES | C=CF.O=S(=O)([O-])c1ccccc1.[Na+] |
| InChI | InChI=1S/C6H6O3S.C2H3F.Na/c7-10(8,9)6-4-2-1-3-5-6;1-2-3;/h1-5H,(H,7,8,9);2H,1H2;/q;;+1/p-1 |
| InChIKey | AFVBZMITUZRMBD-UHFFFAOYSA-M |
| XLogP | -1.31 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.20 |
| LogP ≤ 5 | -1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze sodium;benzenesulfonate;fluoroethene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;benzenesulfonate;fluoroethene?
The IUPAC name of sodium;benzenesulfonate;fluoroethene (CID 159746801) is sodium;benzenesulfonate;fluoroethene.
What is the SMILES notation for sodium;benzenesulfonate;fluoroethene?
The canonical SMILES for sodium;benzenesulfonate;fluoroethene is C=CF.O=S(=O)([O-])c1ccccc1.[Na+].
What is the InChIKey of sodium;benzenesulfonate;fluoroethene?
The InChIKey is AFVBZMITUZRMBD-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H6O3S.C2H3F.Na/c7-10(8,9)6-4-2-1-3-5-6;1-2-3;/h1-5H,(H,7,8,9);2H,1H2;/q;;+1/p-1.
What are the key properties of sodium;benzenesulfonate;fluoroethene?
sodium;benzenesulfonate;fluoroethene has a molecular weight of 226.20 g/mol, XLogP of -1.31, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;benzenesulfonate;fluoroethene is sourced from PubChem (CID 159746801), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).