About lithium;benzenesulfonate;pentafluoro-λ5-phosphane
lithium;benzenesulfonate;pentafluoro-λ5-phosphane (PubChem CID 157098651) has the molecular formula C6H5F5LiO3PS
and a molecular weight of 290.07 g/mol. Its IUPAC name is lithium;benzenesulfonate;pentafluoro-λ5-phosphane.
Molecular Properties
| Compound Name | lithium;benzenesulfonate;pentafluoro-λ5-phosphane |
| PubChem CID | 157098651 |
| Molecular Formula | C6H5F5LiO3PS |
| Molecular Weight | 290.07 g/mol |
| Exact Mass | 289.98 |
| IUPAC Name | lithium;benzenesulfonate;pentafluoro-λ5-phosphane |
| SMILES | FP(F)(F)(F)F.O=S(=O)([O-])c1ccccc1.[Li+] |
| InChI | InChI=1S/C6H6O3S.F5P.Li/c7-10(8,9)6-4-2-1-3-5-6;1-6(2,3,4)5;/h1-5H,(H,7,8,9);;/q;;+1/p-1 |
| InChIKey | FASDMNVGTGRKIA-UHFFFAOYSA-M |
| XLogP | 0.56 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.07 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze lithium;benzenesulfonate;pentafluoro-λ5-phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium;benzenesulfonate;pentafluoro-λ5-phosphane?
The IUPAC name of lithium;benzenesulfonate;pentafluoro-λ5-phosphane (CID 157098651) is lithium;benzenesulfonate;pentafluoro-λ5-phosphane.
What is the SMILES notation for lithium;benzenesulfonate;pentafluoro-λ5-phosphane?
The canonical SMILES for lithium;benzenesulfonate;pentafluoro-λ5-phosphane is FP(F)(F)(F)F.O=S(=O)([O-])c1ccccc1.[Li+].
What is the InChIKey of lithium;benzenesulfonate;pentafluoro-λ5-phosphane?
The InChIKey is FASDMNVGTGRKIA-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H6O3S.F5P.Li/c7-10(8,9)6-4-2-1-3-5-6;1-6(2,3,4)5;/h1-5H,(H,7,8,9);;/q;;+1/p-1.
What are the key properties of lithium;benzenesulfonate;pentafluoro-λ5-phosphane?
lithium;benzenesulfonate;pentafluoro-λ5-phosphane has a molecular weight of 290.07 g/mol, XLogP of 0.56, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for lithium;benzenesulfonate;pentafluoro-λ5-phosphane is sourced from PubChem (CID 157098651), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).