About benzenesulfonate;diphenylphosphane;mercury(1+)
benzenesulfonate;diphenylphosphane;mercury(1+) (PubChem CID 88837367) has the molecular formula C18H16HgO3PS
and a molecular weight of 543.95 g/mol. Its IUPAC name is benzenesulfonate;diphenylphosphane;mercury(1+).
Molecular Properties
| Compound Name | benzenesulfonate;diphenylphosphane;mercury(1+) |
| PubChem CID | 88837367 |
| Molecular Formula | C18H16HgO3PS |
| Molecular Weight | 543.95 g/mol |
| Exact Mass | 545.03 |
| IUPAC Name | benzenesulfonate;diphenylphosphane;mercury(1+) |
| SMILES | O=S(=O)([O-])c1ccccc1.[Hg+].c1ccc(Pc2ccccc2)cc1 |
| InChI | InChI=1S/C12H11P.C6H6O3S.Hg/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;7-10(8,9)6-4-2-1-3-5-6;/h1-10,13H;1-5H,(H,7,8,9);/q;;+1/p-1 |
| InChIKey | VBNYLOKPGRJMHD-UHFFFAOYSA-M |
| XLogP | 2.90 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 543.95 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze benzenesulfonate;diphenylphosphane;mercury(1+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzenesulfonate;diphenylphosphane;mercury(1+)?
The IUPAC name of benzenesulfonate;diphenylphosphane;mercury(1+) (CID 88837367) is benzenesulfonate;diphenylphosphane;mercury(1+).
What is the SMILES notation for benzenesulfonate;diphenylphosphane;mercury(1+)?
The canonical SMILES for benzenesulfonate;diphenylphosphane;mercury(1+) is O=S(=O)([O-])c1ccccc1.[Hg+].c1ccc(Pc2ccccc2)cc1.
What is the InChIKey of benzenesulfonate;diphenylphosphane;mercury(1+)?
The InChIKey is VBNYLOKPGRJMHD-UHFFFAOYSA-M. The full InChI is InChI=1S/C12H11P.C6H6O3S.Hg/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;7-10(8,9)6-4-2-1-3-5-6;/h1-10,13H;1-5H,(H,7,8,9);/q;;+1/p-1.
What are the key properties of benzenesulfonate;diphenylphosphane;mercury(1+)?
benzenesulfonate;diphenylphosphane;mercury(1+) has a molecular weight of 543.95 g/mol, XLogP of 2.90, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzenesulfonate;diphenylphosphane;mercury(1+) is sourced from PubChem (CID 88837367), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).