About sodium;benzenesulfonate;hydrate
sodium;benzenesulfonate;hydrate (PubChem CID 23670746) has the molecular formula C6H7NaO4S
and a molecular weight of 198.18 g/mol. Its IUPAC name is sodium;benzenesulfonate;hydrate.
Molecular Properties
| Compound Name | sodium;benzenesulfonate;hydrate |
| PubChem CID | 23670746 |
| Molecular Formula | C6H7NaO4S |
| Molecular Weight | 198.18 g/mol |
| Exact Mass | 198.00 |
| IUPAC Name | sodium;benzenesulfonate;hydrate |
| SMILES | O.O=S(=O)([O-])c1ccccc1.[Na+] |
| InChI | InChI=1S/C6H6O3S.Na.H2O/c7-10(8,9)6-4-2-1-3-5-6;;/h1-5H,(H,7,8,9);;1H2/q;+1;/p-1 |
| InChIKey | OETNSIFETJNLBD-UHFFFAOYSA-M |
| XLogP | -3.23 |
| TPSA | 88.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.18 |
| LogP ≤ 5 | -3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze sodium;benzenesulfonate;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;benzenesulfonate;hydrate?
The IUPAC name of sodium;benzenesulfonate;hydrate (CID 23670746) is sodium;benzenesulfonate;hydrate.
What is the SMILES notation for sodium;benzenesulfonate;hydrate?
The canonical SMILES for sodium;benzenesulfonate;hydrate is O.O=S(=O)([O-])c1ccccc1.[Na+].
What is the InChIKey of sodium;benzenesulfonate;hydrate?
The InChIKey is OETNSIFETJNLBD-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H6O3S.Na.H2O/c7-10(8,9)6-4-2-1-3-5-6;;/h1-5H,(H,7,8,9);;1H2/q;+1;/p-1.
What are the key properties of sodium;benzenesulfonate;hydrate?
sodium;benzenesulfonate;hydrate has a molecular weight of 198.18 g/mol, XLogP of -3.23, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;benzenesulfonate;hydrate is sourced from PubChem (CID 23670746), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).