About calcium;benzenesulfonate;hydrate
calcium;benzenesulfonate;hydrate (PubChem CID 21150224) has the molecular formula C6H7CaO4S+
and a molecular weight of 215.26 g/mol. Its IUPAC name is calcium;benzenesulfonate;hydrate.
Molecular Properties
| Compound Name | calcium;benzenesulfonate;hydrate |
| PubChem CID | 21150224 |
| Molecular Formula | C6H7CaO4S+ |
| Molecular Weight | 215.26 g/mol |
| Exact Mass | 214.97 |
| IUPAC Name | calcium;benzenesulfonate;hydrate |
| SMILES | O.O=S(=O)([O-])c1ccccc1.[Ca+2] |
| InChI | InChI=1S/C6H6O3S.Ca.H2O/c7-10(8,9)6-4-2-1-3-5-6;;/h1-5H,(H,7,8,9);;1H2/q;+2;/p-1 |
| InChIKey | VLIYSVDOWAEGEK-UHFFFAOYSA-M |
| XLogP | -0.61 |
| TPSA | 88.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.26 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze calcium;benzenesulfonate;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of calcium;benzenesulfonate;hydrate?
The IUPAC name of calcium;benzenesulfonate;hydrate (CID 21150224) is calcium;benzenesulfonate;hydrate.
What is the SMILES notation for calcium;benzenesulfonate;hydrate?
The canonical SMILES for calcium;benzenesulfonate;hydrate is O.O=S(=O)([O-])c1ccccc1.[Ca+2].
What is the InChIKey of calcium;benzenesulfonate;hydrate?
The InChIKey is VLIYSVDOWAEGEK-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H6O3S.Ca.H2O/c7-10(8,9)6-4-2-1-3-5-6;;/h1-5H,(H,7,8,9);;1H2/q;+2;/p-1.
What are the key properties of calcium;benzenesulfonate;hydrate?
calcium;benzenesulfonate;hydrate has a molecular weight of 215.26 g/mol, XLogP of -0.61, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for calcium;benzenesulfonate;hydrate is sourced from PubChem (CID 21150224), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).