About benzenesulfonate;cadmium(2+)
benzenesulfonate;cadmium(2+) (PubChem CID 22604243) has the molecular formula C12H10CdO6S2
and a molecular weight of 426.75 g/mol. Its IUPAC name is benzenesulfonate;cadmium(2+).
Molecular Properties
| Compound Name | benzenesulfonate;cadmium(2+) |
| PubChem CID | 22604243 |
| Molecular Formula | C12H10CdO6S2 |
| Molecular Weight | 426.75 g/mol |
| Exact Mass | 427.90 |
| IUPAC Name | benzenesulfonate;cadmium(2+) |
| SMILES | O=S(=O)([O-])c1ccccc1.O=S(=O)([O-])c1ccccc1.[Cd+2] |
| InChI | InChI=1S/2C6H6O3S.Cd/c2*7-10(8,9)6-4-2-1-3-5-6;/h2*1-5H,(H,7,8,9);/q;;+2/p-2 |
| InChIKey | RXXNEDRIDAZJGY-UHFFFAOYSA-L |
| XLogP | 1.18 |
| TPSA | 114.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 426.75 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze benzenesulfonate;cadmium(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzenesulfonate;cadmium(2+)?
The IUPAC name of benzenesulfonate;cadmium(2+) (CID 22604243) is benzenesulfonate;cadmium(2+).
What is the SMILES notation for benzenesulfonate;cadmium(2+)?
The canonical SMILES for benzenesulfonate;cadmium(2+) is O=S(=O)([O-])c1ccccc1.O=S(=O)([O-])c1ccccc1.[Cd+2].
What is the InChIKey of benzenesulfonate;cadmium(2+)?
The InChIKey is RXXNEDRIDAZJGY-UHFFFAOYSA-L. The full InChI is InChI=1S/2C6H6O3S.Cd/c2*7-10(8,9)6-4-2-1-3-5-6;/h2*1-5H,(H,7,8,9);/q;;+2/p-2.
What are the key properties of benzenesulfonate;cadmium(2+)?
benzenesulfonate;cadmium(2+) has a molecular weight of 426.75 g/mol, XLogP of 1.18, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for benzenesulfonate;cadmium(2+) is sourced from PubChem (CID 22604243), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).