About naphthalen-1-ol;2-prop-2-enylphenol
naphthalen-1-ol;2-prop-2-enylphenol (PubChem CID 174719033) has the molecular formula C19H18O2
and a molecular weight of 278.35 g/mol. Its IUPAC name is naphthalen-1-ol;2-prop-2-enylphenol.
Molecular Properties
| Compound Name | naphthalen-1-ol;2-prop-2-enylphenol |
| PubChem CID | 174719033 |
| Molecular Formula | C19H18O2 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | naphthalen-1-ol;2-prop-2-enylphenol |
| SMILES | C=CCc1ccccc1O.Oc1cccc2ccccc12 |
| InChI | InChI=1S/C10H8O.C9H10O/c11-10-7-3-5-8-4-1-2-6-9(8)10;1-2-5-8-6-3-4-7-9(8)10/h1-7,11H;2-4,6-7,10H,1,5H2 |
| InChIKey | UQMSPDZHISQXAA-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze naphthalen-1-ol;2-prop-2-enylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of naphthalen-1-ol;2-prop-2-enylphenol?
The IUPAC name of naphthalen-1-ol;2-prop-2-enylphenol (CID 174719033) is naphthalen-1-ol;2-prop-2-enylphenol.
What is the SMILES notation for naphthalen-1-ol;2-prop-2-enylphenol?
The canonical SMILES for naphthalen-1-ol;2-prop-2-enylphenol is C=CCc1ccccc1O.Oc1cccc2ccccc12.
What is the InChIKey of naphthalen-1-ol;2-prop-2-enylphenol?
The InChIKey is UQMSPDZHISQXAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8O.C9H10O/c11-10-7-3-5-8-4-1-2-6-9(8)10;1-2-5-8-6-3-4-7-9(8)10/h1-7,11H;2-4,6-7,10H,1,5H2.
What are the key properties of naphthalen-1-ol;2-prop-2-enylphenol?
naphthalen-1-ol;2-prop-2-enylphenol has a molecular weight of 278.35 g/mol, XLogP of 4.67, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for naphthalen-1-ol;2-prop-2-enylphenol is sourced from PubChem (CID 174719033), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).