C9H9O3RbS — CID 140773324
2-prop-2-enylbenzenesulfonate;rubidium(1+) (PubChem CID 140773324) has the molecular formula C9H9O3RbS and a molecular weight of 282.70 g/mol. Its IUPAC name is 2-prop-2-enylbenzenesulfonate;rubidium(1+).
| Compound Name | 2-prop-2-enylbenzenesulfonate;rubidium(1+) |
|---|---|
| PubChem CID | 140773324 |
| Molecular Formula | C9H9O3RbS |
| Molecular Weight | 282.70 g/mol |
| Exact Mass | 281.94 |
| IUPAC Name | 2-prop-2-enylbenzenesulfonate;rubidium(1+) |
| SMILES | C=CCc1ccccc1S(=O)(=O)[O-].[Rb+] |
| InChI | InChI=1S/C9H10O3S.Rb/c1-2-5-8-6-3-4-7-9(8)13(10,11)12;/h2-4,6-7H,1,5H2,(H,10,11,12);/q;+1/p-1 |
| InChIKey | FOBMMQIIIHFCNP-UHFFFAOYSA-M |
| XLogP | -1.68 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.70 |
| LogP ≤ 5 | -1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|