C13H21NO5S — CID 175295342
2-(2-hydroxyethylamino)ethanol;2-prop-2-enylbenzenesulfonic acid (PubChem CID 175295342) has the molecular formula C13H21NO5S and a molecular weight of 303.38 g/mol. Its IUPAC name is 2-(2-hydroxyethylamino)ethanol;2-prop-2-enylbenzenesulfonic acid.
| Compound Name | 2-(2-hydroxyethylamino)ethanol;2-prop-2-enylbenzenesulfonic acid |
|---|---|
| PubChem CID | 175295342 |
| Molecular Formula | C13H21NO5S |
| Molecular Weight | 303.38 g/mol |
| Exact Mass | 303.11 |
| IUPAC Name | 2-(2-hydroxyethylamino)ethanol;2-prop-2-enylbenzenesulfonic acid |
| SMILES | C=CCc1ccccc1S(=O)(=O)O.OCCNCCO |
| InChI | InChI=1S/C9H10O3S.C4H11NO2/c1-2-5-8-6-3-4-7-9(8)13(10,11)12;6-3-1-5-2-4-7/h2-4,6-7H,1,5H2,(H,10,11,12);5-7H,1-4H2 |
| InChIKey | UQKDKINTMAYPMP-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 106.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.38 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|