C12H15NO4S — CID 175173653
prop-2-enamide;2-prop-2-enylbenzenesulfonic acid (PubChem CID 175173653) has the molecular formula C12H15NO4S and a molecular weight of 269.32 g/mol. Its IUPAC name is prop-2-enamide;2-prop-2-enylbenzenesulfonic acid.
| Compound Name | prop-2-enamide;2-prop-2-enylbenzenesulfonic acid |
|---|---|
| PubChem CID | 175173653 |
| Molecular Formula | C12H15NO4S |
| Molecular Weight | 269.32 g/mol |
| Exact Mass | 269.07 |
| IUPAC Name | prop-2-enamide;2-prop-2-enylbenzenesulfonic acid |
| SMILES | C=CC(N)=O.C=CCc1ccccc1S(=O)(=O)O |
| InChI | InChI=1S/C9H10O3S.C3H5NO/c1-2-5-8-6-3-4-7-9(8)13(10,11)12;1-2-3(4)5/h2-4,6-7H,1,5H2,(H,10,11,12);2H,1H2,(H2,4,5) |
| InChIKey | QEFTYSNFJZSQRY-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 97.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.32 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|