C15H17NaO3S — CID 88829241
sodium 2,3,4-tris(prop-2-enyl)benzenesulfonate (PubChem CID 88829241) has the molecular formula C15H17NaO3S and a molecular weight of 300.36 g/mol. Its IUPAC name is sodium 2,3,4-tris(prop-2-enyl)benzenesulfonate.
| Compound Name | sodium 2,3,4-tris(prop-2-enyl)benzenesulfonate |
|---|---|
| PubChem CID | 88829241 |
| Molecular Formula | C15H17NaO3S |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.08 |
| IUPAC Name | sodium 2,3,4-tris(prop-2-enyl)benzenesulfonate |
| SMILES | C=CCc1ccc(S(=O)(=O)[O-])c(CC=C)c1CC=C.[Na+] |
| InChI | InChI=1S/C15H18O3S.Na/c1-4-7-12-10-11-15(19(16,17)18)14(9-6-3)13(12)8-5-2;/h4-6,10-11H,1-3,7-9H2,(H,16,17,18);/q;+1/p-1 |
| InChIKey | ASSZUIZEBLGQRI-UHFFFAOYSA-M |
| XLogP | -0.22 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|