C24H26O2S — CID 67686702
4-[3,4-bis(prop-2-enyl)phenyl]sulfonyl-1,2-bis(prop-2-enyl)benzene (PubChem CID 67686702) has the molecular formula C24H26O2S and a molecular weight of 378.54 g/mol. Its IUPAC name is 4-[3,4-bis(prop-2-enyl)phenyl]sulfonyl-1,2-bis(prop-2-enyl)benzene.
| Compound Name | 4-[3,4-bis(prop-2-enyl)phenyl]sulfonyl-1,2-bis(prop-2-enyl)benzene |
|---|---|
| PubChem CID | 67686702 |
| Molecular Formula | C24H26O2S |
| Molecular Weight | 378.54 g/mol |
| Exact Mass | 378.17 |
| IUPAC Name | 4-[3,4-bis(prop-2-enyl)phenyl]sulfonyl-1,2-bis(prop-2-enyl)benzene |
| SMILES | C=CCc1ccc(S(=O)(=O)c2ccc(CC=C)c(CC=C)c2)cc1CC=C |
| InChI | InChI=1S/C24H26O2S/c1-5-9-19-13-15-23(17-21(19)11-7-3)27(25,26)24-16-14-20(10-6-2)22(18-24)12-8-4/h5-8,13-18H,1-4,9-12H2 |
| InChIKey | YBZTWDHVBWSFBC-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.54 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|