C14H12Br2O2S — CID 130298857
4-(benzenesulfonyl)-1,2-bis(bromomethyl)benzene (PubChem CID 130298857) has the molecular formula C14H12Br2O2S and a molecular weight of 404.12 g/mol. Its IUPAC name is 4-(benzenesulfonyl)-1,2-bis(bromomethyl)benzene.
| Compound Name | 4-(benzenesulfonyl)-1,2-bis(bromomethyl)benzene |
|---|---|
| PubChem CID | 130298857 |
| Molecular Formula | C14H12Br2O2S |
| Molecular Weight | 404.12 g/mol |
| Exact Mass | 401.89 |
| IUPAC Name | 4-(benzenesulfonyl)-1,2-bis(bromomethyl)benzene |
| SMILES | O=S(=O)(c1ccccc1)c1ccc(CBr)c(CBr)c1 |
| InChI | InChI=1S/C14H12Br2O2S/c15-9-11-6-7-14(8-12(11)10-16)19(17,18)13-4-2-1-3-5-13/h1-8H,9-10H2 |
| InChIKey | NIIYUSVCUFWINY-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.12 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|