C40H44O10S2 — CID 87904811
2-[[2-methoxy-5-[4-methoxy-3-(oxiran-2-ylmethyl)phenyl]sulfonylphenyl]methyl]oxirane;1-methoxy-4-(4-methoxy-3-prop-2-enylphenyl)sulfonyl-2-prop-2-enylbenzene (PubChem CID 87904811) has the molecular formula C40H44O10S2 and a molecular weight of 748.92 g/mol. Its IUPAC name is 2-[[2-methoxy-5-[4-methoxy-3-(oxiran-2-ylmethyl)phenyl]sulfonylphenyl]methyl]oxirane;1-methoxy-4-(4-methoxy-3-prop-2-enylphenyl)sulfonyl-2-prop-2-enylbenzene.
| Compound Name | 2-[[2-methoxy-5-[4-methoxy-3-(oxiran-2-ylmethyl)phenyl]sulfonylphenyl]methyl]oxirane;1-methoxy-4-(4-methoxy-3-prop-2-enylphenyl)sulfonyl-2-prop-2-enylbenzene |
|---|---|
| PubChem CID | 87904811 |
| Molecular Formula | C40H44O10S2 |
| Molecular Weight | 748.92 g/mol |
| Exact Mass | 748.24 |
| IUPAC Name | 2-[[2-methoxy-5-[4-methoxy-3-(oxiran-2-ylmethyl)phenyl]sulfonylphenyl]methyl]oxirane;1-methoxy-4-(4-methoxy-3-prop-2-enylphenyl)sulfonyl-2-prop-2-enylbenzene |
| SMILES | C=CCc1cc(S(=O)(=O)c2ccc(OC)c(CC=C)c2)ccc1OC.COc1ccc(S(=O)(=O)c2ccc(OC)c(CC3CO3)c2)cc1CC1CO1 |
| InChI | InChI=1S/C20H22O6S.C20H22O4S/c1-23-19-5-3-17(9-13(19)7-15-11-25-15)27(21,22)18-4-6-20(24-2)14(10-18)8-16-12-26-16;1-5-7-15-13-17(9-11-19(15)23-3)25(21,22)18-10-12-20(24-4)16(14-18)8-6-2/h3-6,9-10,15-16H,7-8,11-12H2,1-2H3;5-6,9-14H,1-2,7-8H2,3-4H3 |
| InChIKey | LHULPPPZLJICJZ-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 130.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 748.92 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|