C12H16O4 — CID 12052944
2-[(3,4,5-trimethoxyphenyl)methyl]oxirane (PubChem CID 12052944) has the molecular formula C12H16O4 and a molecular weight of 224.26 g/mol. Its IUPAC name is 2-[(3,4,5-trimethoxyphenyl)methyl]oxirane.
| Compound Name | 2-[(3,4,5-trimethoxyphenyl)methyl]oxirane |
|---|---|
| PubChem CID | 12052944 |
| Molecular Formula | C12H16O4 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.10 |
| IUPAC Name | 2-[(3,4,5-trimethoxyphenyl)methyl]oxirane |
| SMILES | COc1cc(CC2CO2)cc(OC)c1OC |
| InChI | InChI=1S/C12H16O4/c1-13-10-5-8(4-9-7-16-9)6-11(14-2)12(10)15-3/h5-6,9H,4,7H2,1-3H3 |
| InChIKey | FAOXGRKCMVPVDZ-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 40.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|