C17H26NO3+ — CID 6950095
(2R)-1,4-dimethyl-2-[(3,4,5-trimethoxyphenyl)methyl]-1,2,3,6-tetrahydropyridin-1-ium (PubChem CID 6950095) has the molecular formula C17H26NO3+ and a molecular weight of 292.40 g/mol. Its IUPAC name is (2R)-1,4-dimethyl-2-[(3,4,5-trimethoxyphenyl)methyl]-1,2,3,6-tetrahydropyridin-1-ium.
| Compound Name | (2R)-1,4-dimethyl-2-[(3,4,5-trimethoxyphenyl)methyl]-1,2,3,6-tetrahydropyridin-1-ium |
|---|---|
| PubChem CID | 6950095 |
| Molecular Formula | C17H26NO3+ |
| Molecular Weight | 292.40 g/mol |
| Exact Mass | 292.19 |
| IUPAC Name | (2R)-1,4-dimethyl-2-[(3,4,5-trimethoxyphenyl)methyl]-1,2,3,6-tetrahydropyridin-1-ium |
| SMILES | COc1cc(C[C@H]2CC(C)=CC[NH+]2C)cc(OC)c1OC |
| InChI | InChI=1S/C17H25NO3/c1-12-6-7-18(2)14(8-12)9-13-10-15(19-3)17(21-5)16(11-13)20-4/h6,10-11,14H,7-9H2,1-5H3/p+1/t14-/m1/s1 |
| InChIKey | TZHZEVMJGGQMTC-CQSZACIVSA-O |
| XLogP | 1.49 |
| TPSA | 32.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.40 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|