C23H32ClNO5 — CID 44628910
6,7-dimethoxy-2,2-dimethyl-1-[(3,4,5-trimethoxyphenyl)methyl]-3,4-dihydro-1H-isoquinolin-2-ium chloride (PubChem CID 44628910) has the molecular formula C23H32ClNO5 and a molecular weight of 437.96 g/mol. Its IUPAC name is 6,7-dimethoxy-2,2-dimethyl-1-[(3,4,5-trimethoxyphenyl)methyl]-3,4-dihydro-1H-isoquinolin-2-ium chloride.
| Compound Name | 6,7-dimethoxy-2,2-dimethyl-1-[(3,4,5-trimethoxyphenyl)methyl]-3,4-dihydro-1H-isoquinolin-2-ium chloride |
|---|---|
| PubChem CID | 44628910 |
| Molecular Formula | C23H32ClNO5 |
| Molecular Weight | 437.96 g/mol |
| Exact Mass | 437.20 |
| IUPAC Name | 6,7-dimethoxy-2,2-dimethyl-1-[(3,4,5-trimethoxyphenyl)methyl]-3,4-dihydro-1H-isoquinolin-2-ium chloride |
| SMILES | COc1cc2c(cc1OC)C(Cc1cc(OC)c(OC)c(OC)c1)[N+](C)(C)CC2.[Cl-] |
| InChI | InChI=1S/C23H32NO5.ClH/c1-24(2)9-8-16-13-19(25-3)20(26-4)14-17(16)18(24)10-15-11-21(27-5)23(29-7)22(12-15)28-6;/h11-14,18H,8-10H2,1-7H3;1H/q+1;/p-1 |
| InChIKey | RZLUXFCKVWNJBM-UHFFFAOYSA-M |
| XLogP | 0.65 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.96 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|