C14H22INO2 — CID 44655595
(1S)-6,7-dimethoxy-1,2,2-trimethyl-3,4-dihydro-1H-isoquinolin-2-ium iodide (PubChem CID 44655595) has the molecular formula C14H22INO2 and a molecular weight of 363.24 g/mol. Its IUPAC name is (1S)-6,7-dimethoxy-1,2,2-trimethyl-3,4-dihydro-1H-isoquinolin-2-ium iodide.
| Compound Name | (1S)-6,7-dimethoxy-1,2,2-trimethyl-3,4-dihydro-1H-isoquinolin-2-ium iodide |
|---|---|
| PubChem CID | 44655595 |
| Molecular Formula | C14H22INO2 |
| Molecular Weight | 363.24 g/mol |
| Exact Mass | 363.07 |
| IUPAC Name | (1S)-6,7-dimethoxy-1,2,2-trimethyl-3,4-dihydro-1H-isoquinolin-2-ium iodide |
| SMILES | COc1cc2c(cc1OC)[C@H](C)[N+](C)(C)CC2.[I-] |
| InChI | InChI=1S/C14H22NO2.HI/c1-10-12-9-14(17-5)13(16-4)8-11(12)6-7-15(10,2)3;/h8-10H,6-7H2,1-5H3;1H/q+1;/p-1/t10-;/m0./s1 |
| InChIKey | FHNHMFLAPXSGDH-PPHPATTJSA-M |
| XLogP | -0.60 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.24 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|