C22H28NO5+ — CID 3078136
(13S,13aR)-2,3,10,11-tetramethoxy-7-methyl-6,8,13,13a-tetrahydro-5H-isoquinolino[2,1-b]isoquinolin-7-ium-13-ol (PubChem CID 3078136) has the molecular formula C22H28NO5+ and a molecular weight of 386.47 g/mol. Its IUPAC name is (13S,13aR)-2,3,10,11-tetramethoxy-7-methyl-6,8,13,13a-tetrahydro-5H-isoquinolino[2,1-b]isoquinolin-7-ium-13-ol.
| Compound Name | (13S,13aR)-2,3,10,11-tetramethoxy-7-methyl-6,8,13,13a-tetrahydro-5H-isoquinolino[2,1-b]isoquinolin-7-ium-13-ol |
|---|---|
| PubChem CID | 3078136 |
| Molecular Formula | C22H28NO5+ |
| Molecular Weight | 386.47 g/mol |
| Exact Mass | 386.20 |
| IUPAC Name | (13S,13aR)-2,3,10,11-tetramethoxy-7-methyl-6,8,13,13a-tetrahydro-5H-isoquinolino[2,1-b]isoquinolin-7-ium-13-ol |
| SMILES | COc1cc2c(cc1OC)[C@@H]1[C@@H](O)c3cc(OC)c(OC)cc3C[N+]1(C)CC2 |
| InChI | InChI=1S/C22H28NO5/c1-23-7-6-13-8-17(25-2)19(27-4)10-15(13)21(23)22(24)16-11-20(28-5)18(26-3)9-14(16)12-23/h8-11,21-22,24H,6-7,12H2,1-5H3/q+1/t21-,22+,23?/m1/s1 |
| InChIKey | JTVHYQSWWPQBIB-AXWGZAFASA-N |
| XLogP | 3.01 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.47 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|