C11H14O4 — CID 71395890
5,6-dimethoxy-2,3-dihydro-1H-indene-1,2-diol (PubChem CID 71395890) has the molecular formula C11H14O4 and a molecular weight of 210.23 g/mol. Its IUPAC name is 5,6-dimethoxy-2,3-dihydro-1H-indene-1,2-diol.
| Compound Name | 5,6-dimethoxy-2,3-dihydro-1H-indene-1,2-diol |
|---|---|
| PubChem CID | 71395890 |
| Molecular Formula | C11H14O4 |
| Molecular Weight | 210.23 g/mol |
| Exact Mass | 210.09 |
| IUPAC Name | 5,6-dimethoxy-2,3-dihydro-1H-indene-1,2-diol |
| SMILES | COc1cc2c(cc1OC)C(O)C(O)C2 |
| InChI | InChI=1S/C11H14O4/c1-14-9-4-6-3-8(12)11(13)7(6)5-10(9)15-2/h4-5,8,11-13H,3H2,1-2H3 |
| InChIKey | ICBKLONTNJCWQD-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.23 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |