C11H13IO2 — CID 46849743
7-(iodomethyl)-3,4-dimethoxybicyclo[4.2.0]octa-1,3,5-triene (PubChem CID 46849743) has the molecular formula C11H13IO2 and a molecular weight of 304.13 g/mol. Its IUPAC name is 7-(iodomethyl)-3,4-dimethoxybicyclo[4.2.0]octa-1,3,5-triene.
| Compound Name | 7-(iodomethyl)-3,4-dimethoxybicyclo[4.2.0]octa-1,3,5-triene |
|---|---|
| PubChem CID | 46849743 |
| Molecular Formula | C11H13IO2 |
| Molecular Weight | 304.13 g/mol |
| Exact Mass | 304.00 |
| IUPAC Name | 7-(iodomethyl)-3,4-dimethoxybicyclo[4.2.0]octa-1,3,5-triene |
| SMILES | COc1cc2c(cc1OC)C(CI)C2 |
| InChI | InChI=1S/C11H13IO2/c1-13-10-4-7-3-8(6-12)9(7)5-11(10)14-2/h4-5,8H,3,6H2,1-2H3 |
| InChIKey | XBSLBLBOMLAYDP-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.13 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|