C24H29IO7 — CID 10030597
(8R,10S)-10-(iodomethyl)-3,4,5,14,15,16-hexamethoxy-9-methylidenetricyclo[10.4.0.02,7]hexadeca-1(16),2,4,6,12,14-hexaen-8-ol (PubChem CID 10030597) has the molecular formula C24H29IO7 and a molecular weight of 556.39 g/mol. Its IUPAC name is (8R,10S)-10-(iodomethyl)-3,4,5,14,15,16-hexamethoxy-9-methylidenetricyclo[10.4.0.02,7]hexadeca-1(16),2,4,6,12,14-hexaen-8-ol.
| Compound Name | (8R,10S)-10-(iodomethyl)-3,4,5,14,15,16-hexamethoxy-9-methylidenetricyclo[10.4.0.02,7]hexadeca-1(16),2,4,6,12,14-hexaen-8-ol |
|---|---|
| PubChem CID | 10030597 |
| Molecular Formula | C24H29IO7 |
| Molecular Weight | 556.39 g/mol |
| Exact Mass | 556.10 |
| IUPAC Name | (8R,10S)-10-(iodomethyl)-3,4,5,14,15,16-hexamethoxy-9-methylidenetricyclo[10.4.0.02,7]hexadeca-1(16),2,4,6,12,14-hexaen-8-ol |
| SMILES | C=C1[C@@H](CI)Cc2cc(OC)c(OC)c(OC)c2-c2c(cc(OC)c(OC)c2OC)[C@@H]1O |
| InChI | InChI=1S/C24H29IO7/c1-12-14(11-25)8-13-9-16(27-2)21(29-4)23(31-6)18(13)19-15(20(12)26)10-17(28-3)22(30-5)24(19)32-7/h9-10,14,20,26H,1,8,11H2,2-7H3/t14-,20-/m1/s1 |
| InChIKey | YVVWZCCQZGECSW-JLTOFOAXSA-N |
| XLogP | 4.60 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.39 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|