C28H38O8 — CID 46856029
[(9R,10R)-3,4,5,14,15,16-hexamethoxy-9,10-dimethyl-9-tricyclo[10.4.0.02,7]hexadeca-1(16),2,4,6,12,14-hexaenyl] butanoate (PubChem CID 46856029) has the molecular formula C28H38O8 and a molecular weight of 502.60 g/mol. Its IUPAC name is [(9R,10R)-3,4,5,14,15,16-hexamethoxy-9,10-dimethyl-9-tricyclo[10.4.0.02,7]hexadeca-1(16),2,4,6,12,14-hexaenyl] butanoate.
| Compound Name | [(9R,10R)-3,4,5,14,15,16-hexamethoxy-9,10-dimethyl-9-tricyclo[10.4.0.02,7]hexadeca-1(16),2,4,6,12,14-hexaenyl] butanoate |
|---|---|
| PubChem CID | 46856029 |
| Molecular Formula | C28H38O8 |
| Molecular Weight | 502.60 g/mol |
| Exact Mass | 502.26 |
| IUPAC Name | [(9R,10R)-3,4,5,14,15,16-hexamethoxy-9,10-dimethyl-9-tricyclo[10.4.0.02,7]hexadeca-1(16),2,4,6,12,14-hexaenyl] butanoate |
| SMILES | CCCC(=O)O[C@]1(C)Cc2cc(OC)c(OC)c(OC)c2-c2c(cc(OC)c(OC)c2OC)C[C@H]1C |
| InChI | InChI=1S/C28H38O8/c1-10-11-21(29)36-28(3)15-18-14-20(31-5)25(33-7)27(35-9)23(18)22-17(12-16(28)2)13-19(30-4)24(32-6)26(22)34-8/h13-14,16H,10-12,15H2,1-9H3/t16-,28-/m1/s1 |
| InChIKey | OEQPSAFLRQDIBF-WVDZOPJMSA-N |
| XLogP | 5.24 |
| TPSA | 81.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.60 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |