C23H30O7 — CID 14214005
3,4,14,15,16-pentamethoxy-9,10-dimethyltricyclo[10.4.0.02,7]hexadeca-1(16),2,4,6,12,14-hexaene-5,10-diol (PubChem CID 14214005) has the molecular formula C23H30O7 and a molecular weight of 418.49 g/mol. Its IUPAC name is 3,4,14,15,16-pentamethoxy-9,10-dimethyltricyclo[10.4.0.02,7]hexadeca-1(16),2,4,6,12,14-hexaene-5,10-diol.
| Compound Name | 3,4,14,15,16-pentamethoxy-9,10-dimethyltricyclo[10.4.0.02,7]hexadeca-1(16),2,4,6,12,14-hexaene-5,10-diol |
|---|---|
| PubChem CID | 14214005 |
| Molecular Formula | C23H30O7 |
| Molecular Weight | 418.49 g/mol |
| Exact Mass | 418.20 |
| IUPAC Name | 3,4,14,15,16-pentamethoxy-9,10-dimethyltricyclo[10.4.0.02,7]hexadeca-1(16),2,4,6,12,14-hexaene-5,10-diol |
| SMILES | COc1cc2c(c(OC)c1OC)-c1c(cc(O)c(OC)c1OC)CC(C)C(C)(O)C2 |
| InChI | InChI=1S/C23H30O7/c1-12-8-13-9-15(24)19(27-4)21(29-6)17(13)18-14(11-23(12,2)25)10-16(26-3)20(28-5)22(18)30-7/h9-10,12,24-25H,8,11H2,1-7H3 |
| InChIKey | LZUYISWUVHJQPR-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 86.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.49 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |