C21H26O6 — CID 46832246
(9R,10S)-4,14,15-trimethoxy-9,10-dimethyltricyclo[10.4.0.02,7]hexadeca-1(16),2,4,6,12,14-hexaene-3,5,16-triol (PubChem CID 46832246) has the molecular formula C21H26O6 and a molecular weight of 374.43 g/mol. Its IUPAC name is (9R,10S)-4,14,15-trimethoxy-9,10-dimethyltricyclo[10.4.0.02,7]hexadeca-1(16),2,4,6,12,14-hexaene-3,5,16-triol.
| Compound Name | (9R,10S)-4,14,15-trimethoxy-9,10-dimethyltricyclo[10.4.0.02,7]hexadeca-1(16),2,4,6,12,14-hexaene-3,5,16-triol |
|---|---|
| PubChem CID | 46832246 |
| Molecular Formula | C21H26O6 |
| Molecular Weight | 374.43 g/mol |
| Exact Mass | 374.17 |
| IUPAC Name | (9R,10S)-4,14,15-trimethoxy-9,10-dimethyltricyclo[10.4.0.02,7]hexadeca-1(16),2,4,6,12,14-hexaene-3,5,16-triol |
| SMILES | COc1cc2c(c(O)c1OC)-c1c(cc(O)c(OC)c1O)C[C@@H](C)[C@@H](C)C2 |
| InChI | InChI=1S/C21H26O6/c1-10-6-12-8-14(22)20(26-4)18(23)16(12)17-13(7-11(10)2)9-15(25-3)21(27-5)19(17)24/h8-11,22-24H,6-7H2,1-5H3/t10-,11+/m1/s1 |
| InChIKey | FEKVZUDOFFNYLV-MNOVXSKESA-N |
| XLogP | 3.87 |
| TPSA | 88.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.43 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |