C23H29BrO6 — CID 90671321
(9S,10R)-6-bromo-4,5,14,15,16-pentamethoxy-9,10-dimethyltricyclo[10.4.0.02,7]hexadeca-1(16),2(7),3,5,12,14-hexaen-3-ol (PubChem CID 90671321) has the molecular formula C23H29BrO6 and a molecular weight of 481.38 g/mol. Its IUPAC name is (9S,10R)-6-bromo-4,5,14,15,16-pentamethoxy-9,10-dimethyltricyclo[10.4.0.02,7]hexadeca-1(16),2(7),3,5,12,14-hexaen-3-ol.
| Compound Name | (9S,10R)-6-bromo-4,5,14,15,16-pentamethoxy-9,10-dimethyltricyclo[10.4.0.02,7]hexadeca-1(16),2(7),3,5,12,14-hexaen-3-ol |
|---|---|
| PubChem CID | 90671321 |
| Molecular Formula | C23H29BrO6 |
| Molecular Weight | 481.38 g/mol |
| Exact Mass | 480.11 |
| IUPAC Name | (9S,10R)-6-bromo-4,5,14,15,16-pentamethoxy-9,10-dimethyltricyclo[10.4.0.02,7]hexadeca-1(16),2(7),3,5,12,14-hexaen-3-ol |
| SMILES | COc1cc2c(c(OC)c1OC)-c1c(O)c(OC)c(OC)c(Br)c1C[C@H](C)[C@H](C)C2 |
| InChI | InChI=1S/C23H29BrO6/c1-11-8-13-10-15(26-3)20(27-4)21(28-5)16(13)17-14(9-12(11)2)18(24)22(29-6)23(30-7)19(17)25/h10-12,25H,8-9H2,1-7H3/t11-,12+/m1/s1 |
| InChIKey | MUIIULNTPGGEFQ-NEPJUHHUSA-N |
| XLogP | 5.24 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.38 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |