C23H28O7 — CID 102106602
(10R)-3,4,5,14,15,16-hexamethoxy-10-methyltricyclo[10.4.0.02,7]hexadeca-1(16),2,4,6,12,14-hexaen-9-one (PubChem CID 102106602) has the molecular formula C23H28O7 and a molecular weight of 416.47 g/mol. Its IUPAC name is (10R)-3,4,5,14,15,16-hexamethoxy-10-methyltricyclo[10.4.0.02,7]hexadeca-1(16),2,4,6,12,14-hexaen-9-one.
| Compound Name | (10R)-3,4,5,14,15,16-hexamethoxy-10-methyltricyclo[10.4.0.02,7]hexadeca-1(16),2,4,6,12,14-hexaen-9-one |
|---|---|
| PubChem CID | 102106602 |
| Molecular Formula | C23H28O7 |
| Molecular Weight | 416.47 g/mol |
| Exact Mass | 416.18 |
| IUPAC Name | (10R)-3,4,5,14,15,16-hexamethoxy-10-methyltricyclo[10.4.0.02,7]hexadeca-1(16),2,4,6,12,14-hexaen-9-one |
| SMILES | COc1cc2c(c(OC)c1OC)-c1c(cc(OC)c(OC)c1OC)C[C@@H](C)C(=O)C2 |
| InChI | InChI=1S/C23H28O7/c1-12-8-13-10-16(25-2)20(27-4)22(29-6)18(13)19-14(9-15(12)24)11-17(26-3)21(28-5)23(19)30-7/h10-12H,8-9H2,1-7H3/t12-/m1/s1 |
| InChIKey | HHWUEVZSWQLZKF-GFCCVEGCSA-N |
| XLogP | 3.71 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.47 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |