C20H24O6S — CID 86074646
1,2,3,9,10,11-hexamethoxy-5,7-dihydrobenzo[d][2]benzothiepine (PubChem CID 86074646) has the molecular formula C20H24O6S and a molecular weight of 392.47 g/mol. Its IUPAC name is 1,2,3,9,10,11-hexamethoxy-5,7-dihydrobenzo[d][2]benzothiepine.
| Compound Name | 1,2,3,9,10,11-hexamethoxy-5,7-dihydrobenzo[d][2]benzothiepine |
|---|---|
| PubChem CID | 86074646 |
| Molecular Formula | C20H24O6S |
| Molecular Weight | 392.47 g/mol |
| Exact Mass | 392.13 |
| IUPAC Name | 1,2,3,9,10,11-hexamethoxy-5,7-dihydrobenzo[d][2]benzothiepine |
| SMILES | COc1cc2c(c(OC)c1OC)-c1c(cc(OC)c(OC)c1OC)CSC2 |
| InChI | InChI=1S/C20H24O6S/c1-21-13-7-11-9-27-10-12-8-14(22-2)18(24-4)20(26-6)16(12)15(11)19(25-5)17(13)23-3/h7-8H,9-10H2,1-6H3 |
| InChIKey | NGLNLVHGZCDOEO-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.47 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |