C18H24O6P2 — CID 59989489
[3,4,5-trimethoxy-2-(2,3,4-trimethoxy-6-phosphanylphenyl)phenyl]phosphane (PubChem CID 59989489) has the molecular formula C18H24O6P2 and a molecular weight of 398.33 g/mol. Its IUPAC name is [3,4,5-trimethoxy-2-(2,3,4-trimethoxy-6-phosphanylphenyl)phenyl]phosphane.
| Compound Name | [3,4,5-trimethoxy-2-(2,3,4-trimethoxy-6-phosphanylphenyl)phenyl]phosphane |
|---|---|
| PubChem CID | 59989489 |
| Molecular Formula | C18H24O6P2 |
| Molecular Weight | 398.33 g/mol |
| Exact Mass | 398.10 |
| IUPAC Name | [3,4,5-trimethoxy-2-(2,3,4-trimethoxy-6-phosphanylphenyl)phenyl]phosphane |
| SMILES | COc1cc(P)c(-c2c(P)cc(OC)c(OC)c2OC)c(OC)c1OC |
| InChI | InChI=1S/C18H24O6P2/c1-19-9-7-11(25)13(17(23-5)15(9)21-3)14-12(26)8-10(20-2)16(22-4)18(14)24-6/h7-8H,25-26H2,1-6H3 |
| InChIKey | GXIQKEXEPMDDHA-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.33 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|