C12H20O4 — CID 157228165
methane;1,2,3,4-tetramethoxy-5-methylbenzene (PubChem CID 157228165) has the molecular formula C12H20O4 and a molecular weight of 228.29 g/mol. Its IUPAC name is methane;1,2,3,4-tetramethoxy-5-methylbenzene.
| Compound Name | methane;1,2,3,4-tetramethoxy-5-methylbenzene |
|---|---|
| PubChem CID | 157228165 |
| Molecular Formula | C12H20O4 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.14 |
| IUPAC Name | methane;1,2,3,4-tetramethoxy-5-methylbenzene |
| SMILES | C.COc1cc(C)c(OC)c(OC)c1OC |
| InChI | InChI=1S/C11H16O4.CH4/c1-7-6-8(12-2)10(14-4)11(15-5)9(7)13-3;/h6H,1-5H3;1H4 |
| InChIKey | ATUGTRARVLVZMC-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |