C17H32O2 — CID 143060734
5-tert-butyl-1,2-dimethoxy-3-methylbenzene;ethane (PubChem CID 143060734) has the molecular formula C17H32O2 and a molecular weight of 268.44 g/mol. Its IUPAC name is 5-tert-butyl-1,2-dimethoxy-3-methylbenzene;ethane.
| Compound Name | 5-tert-butyl-1,2-dimethoxy-3-methylbenzene;ethane |
|---|---|
| PubChem CID | 143060734 |
| Molecular Formula | C17H32O2 |
| Molecular Weight | 268.44 g/mol |
| Exact Mass | 268.24 |
| IUPAC Name | 5-tert-butyl-1,2-dimethoxy-3-methylbenzene;ethane |
| SMILES | CC.CC.COc1cc(C(C)(C)C)cc(C)c1OC |
| InChI | InChI=1S/C13H20O2.2C2H6/c1-9-7-10(13(2,3)4)8-11(14-5)12(9)15-6;2*1-2/h7-8H,1-6H3;2*1-2H3 |
| InChIKey | ZINHAGODOPROPY-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.44 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |