C18H30O4 — CID 23270185
2,2,4,4-tetramethyl-3-(3,4,5-trimethoxyphenyl)pentan-3-ol (PubChem CID 23270185) has the molecular formula C18H30O4 and a molecular weight of 310.43 g/mol. Its IUPAC name is 2,2,4,4-tetramethyl-3-(3,4,5-trimethoxyphenyl)pentan-3-ol.
| Compound Name | 2,2,4,4-tetramethyl-3-(3,4,5-trimethoxyphenyl)pentan-3-ol |
|---|---|
| PubChem CID | 23270185 |
| Molecular Formula | C18H30O4 |
| Molecular Weight | 310.43 g/mol |
| Exact Mass | 310.21 |
| IUPAC Name | 2,2,4,4-tetramethyl-3-(3,4,5-trimethoxyphenyl)pentan-3-ol |
| SMILES | COc1cc(C(O)(C(C)(C)C)C(C)(C)C)cc(OC)c1OC |
| InChI | InChI=1S/C18H30O4/c1-16(2,3)18(19,17(4,5)6)12-10-13(20-7)15(22-9)14(11-12)21-8/h10-11,19H,1-9H3 |
| InChIKey | VRGDIWSZSUZILM-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.43 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |