C24H34O8 — CID 10939314
2,3-dimethyl-1,4-bis(3,4,5-trimethoxyphenyl)butane-2,3-diol (PubChem CID 10939314) has the molecular formula C24H34O8 and a molecular weight of 450.53 g/mol. Its IUPAC name is 2,3-dimethyl-1,4-bis(3,4,5-trimethoxyphenyl)butane-2,3-diol.
| Compound Name | 2,3-dimethyl-1,4-bis(3,4,5-trimethoxyphenyl)butane-2,3-diol |
|---|---|
| PubChem CID | 10939314 |
| Molecular Formula | C24H34O8 |
| Molecular Weight | 450.53 g/mol |
| Exact Mass | 450.23 |
| IUPAC Name | 2,3-dimethyl-1,4-bis(3,4,5-trimethoxyphenyl)butane-2,3-diol |
| SMILES | COc1cc(CC(C)(O)C(C)(O)Cc2cc(OC)c(OC)c(OC)c2)cc(OC)c1OC |
| InChI | InChI=1S/C24H34O8/c1-23(25,13-15-9-17(27-3)21(31-7)18(10-15)28-4)24(2,26)14-16-11-19(29-5)22(32-8)20(12-16)30-6/h9-12,25-26H,13-14H2,1-8H3 |
| InChIKey | HZRNHCRIWWGHKJ-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 95.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.53 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |