C15H25NO4 — CID 62816210
2-methyl-3-[(3,4,5-trimethoxyphenyl)methylamino]butan-2-ol (PubChem CID 62816210) has the molecular formula C15H25NO4 and a molecular weight of 283.37 g/mol. Its IUPAC name is 2-methyl-3-[(3,4,5-trimethoxyphenyl)methylamino]butan-2-ol.
| Compound Name | 2-methyl-3-[(3,4,5-trimethoxyphenyl)methylamino]butan-2-ol |
|---|---|
| PubChem CID | 62816210 |
| Molecular Formula | C15H25NO4 |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.18 |
| IUPAC Name | 2-methyl-3-[(3,4,5-trimethoxyphenyl)methylamino]butan-2-ol |
| SMILES | COc1cc(CNC(C)C(C)(C)O)cc(OC)c1OC |
| InChI | InChI=1S/C15H25NO4/c1-10(15(2,3)17)16-9-11-7-12(18-4)14(20-6)13(8-11)19-5/h7-8,10,16-17H,9H2,1-6H3 |
| InChIKey | MOEPSAFNMYERBU-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 59.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |