methyl 2-[(3,4,5-trimethoxyphenyl)methylamino]propanoate

C14H21NO5 — CID 60780797

IUPACmethyl 2-[(3,4,5-trimethoxyphenyl)methylamino]propanoate
SMILESCOC(=O)C(C)NCc1cc(OC)c(OC)c(OC)c1
InChIInChI=1S/C14H21NO5/c1-9(14(16)20-5)15-8-10-6-11(17-2)13(19-4)12(7-10)18-3/h6-7,9,15H,8H2,1-5H3
InChIKeyJETNMWBVEWCUSV-UHFFFAOYSA-N
MW283.32 g/mol
LogP1.36
Rot. Bonds7

About methyl 2-[(3,4,5-trimethoxyphenyl)methylamino]propanoate

methyl 2-[(3,4,5-trimethoxyphenyl)methylamino]propanoate (PubChem CID 60780797) has the molecular formula C14H21NO5 and a molecular weight of 283.32 g/mol. Its IUPAC name is methyl 2-[(3,4,5-trimethoxyphenyl)methylamino]propanoate.

Molecular Properties

Compound Namemethyl 2-[(3,4,5-trimethoxyphenyl)methylamino]propanoate
PubChem CID60780797
Molecular FormulaC14H21NO5
Molecular Weight283.32 g/mol
Exact Mass283.14
IUPAC Namemethyl 2-[(3,4,5-trimethoxyphenyl)methylamino]propanoate
SMILESCOC(=O)C(C)NCc1cc(OC)c(OC)c(OC)c1
InChIInChI=1S/C14H21NO5/c1-9(14(16)20-5)15-8-10-6-11(17-2)13(19-4)12(7-10)18-3/h6-7,9,15H,8H2,1-5H3
InChIKeyJETNMWBVEWCUSV-UHFFFAOYSA-N
XLogP1.36
TPSA66.02 Ų
H-Bond Donors1
H-Bond Acceptors6
Rotatable Bonds7
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500283.32
LogP ≤ 51.36
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 106

Analyze methyl 2-[(3,4,5-trimethoxyphenyl)methylamino]propanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-[(3,4,5-trimethoxyphenyl)methylamino]propanoate?
The IUPAC name of methyl 2-[(3,4,5-trimethoxyphenyl)methylamino]propanoate (CID 60780797) is methyl 2-[(3,4,5-trimethoxyphenyl)methylamino]propanoate.
What is the SMILES notation for methyl 2-[(3,4,5-trimethoxyphenyl)methylamino]propanoate?
The canonical SMILES for methyl 2-[(3,4,5-trimethoxyphenyl)methylamino]propanoate is COC(=O)C(C)NCc1cc(OC)c(OC)c(OC)c1.
What is the InChIKey of methyl 2-[(3,4,5-trimethoxyphenyl)methylamino]propanoate?
The InChIKey is JETNMWBVEWCUSV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21NO5/c1-9(14(16)20-5)15-8-10-6-11(17-2)13(19-4)12(7-10)18-3/h6-7,9,15H,8H2,1-5H3.
What are the key properties of methyl 2-[(3,4,5-trimethoxyphenyl)methylamino]propanoate?
methyl 2-[(3,4,5-trimethoxyphenyl)methylamino]propanoate has a molecular weight of 283.32 g/mol, XLogP of 1.36, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[(3,4,5-trimethoxyphenyl)methylamino]propanoate is sourced from PubChem (CID 60780797), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).