C25H32O10 — CID 19020979
dimethyl 2,2-bis[(3,4,5-trimethoxyphenyl)methyl]propanedioate (PubChem CID 19020979) has the molecular formula C25H32O10 and a molecular weight of 492.52 g/mol. Its IUPAC name is dimethyl 2,2-bis[(3,4,5-trimethoxyphenyl)methyl]propanedioate.
| Compound Name | dimethyl 2,2-bis[(3,4,5-trimethoxyphenyl)methyl]propanedioate |
|---|---|
| PubChem CID | 19020979 |
| Molecular Formula | C25H32O10 |
| Molecular Weight | 492.52 g/mol |
| Exact Mass | 492.20 |
| IUPAC Name | dimethyl 2,2-bis[(3,4,5-trimethoxyphenyl)methyl]propanedioate |
| SMILES | COC(=O)C(Cc1cc(OC)c(OC)c(OC)c1)(Cc1cc(OC)c(OC)c(OC)c1)C(=O)OC |
| InChI | InChI=1S/C25H32O10/c1-28-17-9-15(10-18(29-2)21(17)32-5)13-25(23(26)34-7,24(27)35-8)14-16-11-19(30-3)22(33-6)20(12-16)31-4/h9-12H,13-14H2,1-8H3 |
| InChIKey | GJNZTAYBHKYVHV-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 107.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.52 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|